C41H35BrO6 — CID 160711335
methyl 2-(bromomethyl)benzoate;4-phenylphenol;2-[(4-phenylphenoxy)methyl]benzoic acid (PubChem CID 160711335) has the molecular formula C41H35BrO6 and a molecular weight of 703.63 g/mol. Its IUPAC name is methyl 2-(bromomethyl)benzoate;4-phenylphenol;2-[(4-phenylphenoxy)methyl]benzoic acid.
| Compound Name | methyl 2-(bromomethyl)benzoate;4-phenylphenol;2-[(4-phenylphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 160711335 |
| Molecular Formula | C41H35BrO6 |
| Molecular Weight | 703.63 g/mol |
| Exact Mass | 702.16 |
| IUPAC Name | methyl 2-(bromomethyl)benzoate;4-phenylphenol;2-[(4-phenylphenoxy)methyl]benzoic acid |
| SMILES | COC(=O)c1ccccc1CBr.O=C(O)c1ccccc1COc1ccc(-c2ccccc2)cc1.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16O3.C12H10O.C9H9BrO2/c21-20(22)19-9-5-4-8-17(19)14-23-18-12-10-16(11-13-18)15-6-2-1-3-7-15;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-12-9(11)8-5-3-2-4-7(8)6-10/h1-13H,14H2,(H,21,22);1-9,13H;2-5H,6H2,1H3 |
| InChIKey | RRWZHSYERIBDBU-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.63 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|