C16H23ClN2O3 — CID 160711504
[(4-acetamidophenyl)-piperidin-2-ylmethyl] acetate;hydrochloride (PubChem CID 160711504) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is [(4-acetamidophenyl)-piperidin-2-ylmethyl] acetate;hydrochloride.
| Compound Name | [(4-acetamidophenyl)-piperidin-2-ylmethyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 160711504 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(4-acetamidophenyl)-piperidin-2-ylmethyl] acetate;hydrochloride |
| SMILES | CC(=O)Nc1ccc(C(OC(C)=O)C2CCCCN2)cc1.Cl |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-11(19)18-14-8-6-13(7-9-14)16(21-12(2)20)15-5-3-4-10-17-15;/h6-9,15-17H,3-5,10H2,1-2H3,(H,18,19);1H |
| InChIKey | RQTVBMDYPLHLIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |