C20H20Cl2N4O2 — CID 68672905
[(3,4-dichlorophenyl)-[(2R)-piperidin-2-yl]methyl] N-(1H-indazol-5-yl)carbamate (PubChem CID 68672905) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)-[(2R)-piperidin-2-yl]methyl] N-(1H-indazol-5-yl)carbamate.
| Compound Name | [(3,4-dichlorophenyl)-[(2R)-piperidin-2-yl]methyl] N-(1H-indazol-5-yl)carbamate |
|---|---|
| PubChem CID | 68672905 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [(3,4-dichlorophenyl)-[(2R)-piperidin-2-yl]methyl] N-(1H-indazol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)OC(c1ccc(Cl)c(Cl)c1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C20H20Cl2N4O2/c21-15-6-4-12(10-16(15)22)19(18-3-1-2-8-23-18)28-20(27)25-14-5-7-17-13(9-14)11-24-26-17/h4-7,9-11,18-19,23H,1-3,8H2,(H,24,26)(H,25,27)/t18-,19?/m1/s1 |
| InChIKey | NERQPBHTWZJQTA-MRTLOADZSA-N |
| XLogP | 5.30 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |