C22H26F3N3O — CID 160715227
2-(3-amino-4-methylphenyl)-1-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanone (PubChem CID 160715227) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-(3-amino-4-methylphenyl)-1-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(3-amino-4-methylphenyl)-1-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 160715227 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-(3-amino-4-methylphenyl)-1-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanone |
| SMILES | Cc1ccc(CC(=O)c2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1N |
| InChI | InChI=1S/C22H26F3N3O/c1-15-3-4-16(11-20(15)26)12-21(29)17-5-6-18(19(13-17)22(23,24)25)14-28-9-7-27(2)8-10-28/h3-6,11,13H,7-10,12,14,26H2,1-2H3 |
| InChIKey | RSJMMWFWIISABB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|