C34H33F3N6O — CID 159047194
2-[4-[2-[2-methyl-5-[2-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]acetyl]phenyl]ethynyl]isoquinolin-1-yl]guanidine (PubChem CID 159047194) has the molecular formula C34H33F3N6O and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[4-[2-[2-methyl-5-[2-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]acetyl]phenyl]ethynyl]isoquinolin-1-yl]guanidine.
| Compound Name | 2-[4-[2-[2-methyl-5-[2-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]acetyl]phenyl]ethynyl]isoquinolin-1-yl]guanidine |
|---|---|
| PubChem CID | 159047194 |
| Molecular Formula | C34H33F3N6O |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 2-[4-[2-[2-methyl-5-[2-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]acetyl]phenyl]ethynyl]isoquinolin-1-yl]guanidine |
| SMILES | Cc1ccc(C(=O)Cc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc(N=C(N)N)c2ccccc12 |
| InChI | InChI=1S/C34H33F3N6O/c1-22-7-9-25(19-24(22)11-12-26-20-40-32(41-33(38)39)29-6-4-3-5-28(26)29)31(44)18-23-8-10-27(30(17-23)34(35,36)37)21-43-15-13-42(2)14-16-43/h3-10,17,19-20H,13-16,18,21H2,1-2H3,(H4,38,39,40,41) |
| InChIKey | DXEQLPOKZAWTNO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|