C28H28F3N7O — CID 167166553
3-[2-(5-amino-6-methanimidoylpyrazin-2-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 167166553) has the molecular formula C28H28F3N7O and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-[2-(5-amino-6-methanimidoylpyrazin-2-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-(5-amino-6-methanimidoylpyrazin-2-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 167166553 |
| Molecular Formula | C28H28F3N7O |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 3-[2-(5-amino-6-methanimidoylpyrazin-2-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | [H]/N=C/c1nc(C#Cc2cc(C(=O)Nc3ccc(CN4CCN(C)CC4)c(C(F)(F)F)c3)ccc2C)cnc1N |
| InChI | InChI=1S/C28H28F3N7O/c1-18-3-4-20(13-19(18)5-8-23-16-34-26(33)25(15-32)35-23)27(39)36-22-7-6-21(24(14-22)28(29,30)31)17-38-11-9-37(2)10-12-38/h3-4,6-7,13-16,32H,9-12,17H2,1-2H3,(H2,33,34)(H,36,39)/b32-15+ |
| InChIKey | RHWCVEITIGDYBO-VWJSQJICSA-N |
| XLogP | 3.78 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|