C15H16N4O5S2 — CID 160718981
2-amino-1,3-thiazol-4-one;(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 160718981) has the molecular formula C15H16N4O5S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-amino-1,3-thiazol-4-one;(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 2-amino-1,3-thiazol-4-one;(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 160718981 |
| Molecular Formula | C15H16N4O5S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-amino-1,3-thiazol-4-one;(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | NC1=NC(=O)CS1.[H]/N=C1\NC(=O)/C(=C/c2cc(OC)c(O)c(OC)c2)S1 |
| InChI | InChI=1S/C12H12N2O4S.C3H4N2OS/c1-17-7-3-6(4-8(18-2)10(7)15)5-9-11(16)14-12(13)19-9;4-3-5-2(6)1-7-3/h3-5,15H,1-2H3,(H2,13,14,16);1H2,(H2,4,5,6)/b9-5-; |
| InChIKey | RSVRVTMLENXDTC-UYTGOYFPSA-N |
| XLogP | 1.12 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|