C22H24N8OS — CID 160724582
4-(3-aminophenyl)sulfanyl-N-[3-(furan-2-yl)-2H-pyrrol-5-yl]-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 160724582) has the molecular formula C22H24N8OS and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-(3-aminophenyl)sulfanyl-N-[3-(furan-2-yl)-2H-pyrrol-5-yl]-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-aminophenyl)sulfanyl-N-[3-(furan-2-yl)-2H-pyrrol-5-yl]-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 160724582 |
| Molecular Formula | C22H24N8OS |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-(3-aminophenyl)sulfanyl-N-[3-(furan-2-yl)-2H-pyrrol-5-yl]-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCN(c2nc(NC3=NCC(c4ccco4)=C3)nc(Sc3cccc(N)c3)n2)CC1 |
| InChI | InChI=1S/C22H24N8OS/c1-29-7-9-30(10-8-29)21-26-20(25-19-12-15(14-24-19)18-6-3-11-31-18)27-22(28-21)32-17-5-2-4-16(23)13-17/h2-6,11-13H,7-10,14,23H2,1H3,(H,24,25,26,27,28) |
| InChIKey | LXKXSIZGOPVVKB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|