About but-3-yn-2-yl N-(3-chlorophenyl)carbamate
but-3-yn-2-yl N-(3-chlorophenyl)carbamate (PubChem CID 16073) has the molecular formula C11H10ClNO2
and a molecular weight of 223.66 g/mol. Its IUPAC name is but-3-yn-2-yl N-(3-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | but-3-yn-2-yl N-(3-chlorophenyl)carbamate |
| PubChem CID | 16073 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | but-3-yn-2-yl N-(3-chlorophenyl)carbamate |
| SMILES | C#CC(C)OC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H10ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h1,4-8H,2H3,(H,13,14) |
| InChIKey | ULBXWWGWDPVHAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-yl N-(3-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-yl N-(3-chlorophenyl)carbamate?
The IUPAC name of but-3-yn-2-yl N-(3-chlorophenyl)carbamate (CID 16073) is but-3-yn-2-yl N-(3-chlorophenyl)carbamate.
What is the SMILES notation for but-3-yn-2-yl N-(3-chlorophenyl)carbamate?
The canonical SMILES for but-3-yn-2-yl N-(3-chlorophenyl)carbamate is C#CC(C)OC(=O)Nc1cccc(Cl)c1.
What is the InChIKey of but-3-yn-2-yl N-(3-chlorophenyl)carbamate?
The InChIKey is ULBXWWGWDPVHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h1,4-8H,2H3,(H,13,14).
What are the key properties of but-3-yn-2-yl N-(3-chlorophenyl)carbamate?
but-3-yn-2-yl N-(3-chlorophenyl)carbamate has a molecular weight of 223.66 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-yl N-(3-chlorophenyl)carbamate is sourced from PubChem (CID 16073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).