About 2-ethylhexylphosphonic acid;octan-2-yl nitrite
2-ethylhexylphosphonic acid;octan-2-yl nitrite (PubChem CID 160730008) has the molecular formula C16H36NO5P
and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-ethylhexylphosphonic acid;octan-2-yl nitrite.
Molecular Properties
| Compound Name | 2-ethylhexylphosphonic acid;octan-2-yl nitrite |
| PubChem CID | 160730008 |
| Molecular Formula | C16H36NO5P |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 2-ethylhexylphosphonic acid;octan-2-yl nitrite |
| SMILES | CCCCC(CC)CP(=O)(O)O.CCCCCCC(C)ON=O |
| InChI | InChI=1S/C8H17NO2.C8H19O3P/c1-3-4-5-6-7-8(2)11-9-10;1-3-5-6-8(4-2)7-12(9,10)11/h8H,3-7H2,1-2H3;8H,3-7H2,1-2H3,(H2,9,10,11) |
| InChIKey | RUFCPDPNKYQJNR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexylphosphonic acid;octan-2-yl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylphosphonic acid;octan-2-yl nitrite?
The IUPAC name of 2-ethylhexylphosphonic acid;octan-2-yl nitrite (CID 160730008) is 2-ethylhexylphosphonic acid;octan-2-yl nitrite.
What is the SMILES notation for 2-ethylhexylphosphonic acid;octan-2-yl nitrite?
The canonical SMILES for 2-ethylhexylphosphonic acid;octan-2-yl nitrite is CCCCC(CC)CP(=O)(O)O.CCCCCCC(C)ON=O.
What is the InChIKey of 2-ethylhexylphosphonic acid;octan-2-yl nitrite?
The InChIKey is RUFCPDPNKYQJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C8H19O3P/c1-3-4-5-6-7-8(2)11-9-10;1-3-5-6-8(4-2)7-12(9,10)11/h8H,3-7H2,1-2H3;8H,3-7H2,1-2H3,(H2,9,10,11).
What are the key properties of 2-ethylhexylphosphonic acid;octan-2-yl nitrite?
2-ethylhexylphosphonic acid;octan-2-yl nitrite has a molecular weight of 353.44 g/mol, XLogP of 5.42, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylphosphonic acid;octan-2-yl nitrite is sourced from PubChem (CID 160730008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).