C19H32O7 — CID 160731897
(1S,2R)-1,5-dihydroxy-2,4-bis(hydroxymethyl)-1-[(2R,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]nonane-3,7-dione (PubChem CID 160731897) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1S,2R)-1,5-dihydroxy-2,4-bis(hydroxymethyl)-1-[(2R,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]nonane-3,7-dione.
| Compound Name | (1S,2R)-1,5-dihydroxy-2,4-bis(hydroxymethyl)-1-[(2R,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]nonane-3,7-dione |
|---|---|
| PubChem CID | 160731897 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (1S,2R)-1,5-dihydroxy-2,4-bis(hydroxymethyl)-1-[(2R,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]nonane-3,7-dione |
| SMILES | C=CC[C@H](C)[C@H]1O[C@]1(C)[C@@H](O)[C@@H](CO)C(=O)C(CO)C(O)CC(=O)CC |
| InChI | InChI=1S/C19H32O7/c1-5-7-11(3)18-19(4,26-18)17(25)14(10-21)16(24)13(9-20)15(23)8-12(22)6-2/h5,11,13-15,17-18,20-21,23,25H,1,6-10H2,2-4H3/t11-,13?,14-,15?,17-,18+,19+/m0/s1 |
| InChIKey | RDGWNXAHPYQZLV-BFXRQOMHSA-N |
| XLogP | 0.23 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|