C26H24O — CID 160733631
5-tert-butyl-6-methyl-18-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene (PubChem CID 160733631) has the molecular formula C26H24O and a molecular weight of 355.50 g/mol. Its IUPAC name is 5-tert-butyl-6-methyl-18-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene.
| Compound Name | 5-tert-butyl-6-methyl-18-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 160733631 |
| Molecular Formula | C26H24O |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 5-tert-butyl-6-methyl-18-(trideuteriomethyl)-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21),17,19-decaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(ccc3ccc4c5ccc(C)c(C(C)(C)C)c5oc4c32)c1 |
| InChI | InChI=1S/C26H24O/c1-15-6-11-19-18(14-15)9-8-17-10-13-20-21-12-7-16(2)23(26(3,4)5)25(21)27-24(20)22(17)19/h6-14H,1-5H3/i1D3 |
| InChIKey | IDZAXAVNOOMDHW-FIBGUPNXSA-N |
| XLogP | 7.81 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|