C49H48IrN2O+ — CID 169040327
CID 169040327 (PubChem CID 169040327) has the molecular formula C49H48IrN2O+ and a molecular weight of 881.20 g/mol.
| Compound Name | CID 169040327 |
|---|---|
| PubChem CID | 169040327 |
| Molecular Formula | C49H48IrN2O+ |
| Molecular Weight | 881.20 g/mol |
| Exact Mass | 881.39 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc(C(C)(C)C)c[n+]2[CH2-])c([CH2-])c1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3ccc3ccc4ccccc4c32)cc1C([2H])([2H])C(C)(C)C.[Ir+3] |
| InChI | InChI=1S/C31H26NO.C18H22N.Ir/c1-19-18-32-27(16-22(19)17-31(2,3)4)26-11-7-10-24-25-15-14-21-13-12-20-8-5-6-9-23(20)28(21)30(25)33-29(24)26;1-13-7-9-16(14(2)11-13)17-10-8-15(12-19(17)6)18(3,4)5;/h5-10,12-16,18H,17H2,1-4H3;7-12H,2,6H2,1,3-5H3;/q2*-1;+3/i1D3,17D2;1D3; |
| InChIKey | ZDKZKUCJXSYYBQ-PZLCDTMQSA-N |
| XLogP | 12.72 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.20 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|