C47H44IrN2O+ — CID 169040312
CID 169040312 (PubChem CID 169040312) has the molecular formula C47H44IrN2O+ and a molecular weight of 847.11 g/mol.
| Compound Name | CID 169040312 |
|---|---|
| PubChem CID | 169040312 |
| Molecular Formula | C47H44IrN2O+ |
| Molecular Weight | 847.11 g/mol |
| Exact Mass | 847.32 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)c1)C(C)(C)C.[CH2-]c1ccccc1-c1ccc(C(C)(C)C)c[n+]1[CH2-].[Ir+3] |
| InChI | InChI=1S/C30H24NO.C17H20N.Ir/c1-30(2,3)18-19-13-14-31-27(15-19)24-10-6-9-23-26-16-21-12-11-20-7-4-5-8-22(20)25(21)17-28(26)32-29(23)24;1-13-8-6-7-9-15(13)16-11-10-14(12-18(16)5)17(2,3)4;/h4-9,11-17H,18H2,1-3H3;6-12H,1,5H2,2-4H3;/q2*-1;+3/i18D2;; |
| InChIKey | DUHXCJADROWMQD-SBZCUTMTSA-N |
| XLogP | 12.10 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.11 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|