C12H21F3N4O — CID 160733750
1-(2-aminoethyl)-3,5-dimethyl-N-propan-2-ylpyrazol-4-amine;2,2,2-trifluoroacetaldehyde (PubChem CID 160733750) has the molecular formula C12H21F3N4O and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3,5-dimethyl-N-propan-2-ylpyrazol-4-amine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 1-(2-aminoethyl)-3,5-dimethyl-N-propan-2-ylpyrazol-4-amine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 160733750 |
| Molecular Formula | C12H21F3N4O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-(2-aminoethyl)-3,5-dimethyl-N-propan-2-ylpyrazol-4-amine;2,2,2-trifluoroacetaldehyde |
| SMILES | Cc1nn(CCN)c(C)c1NC(C)C.O=CC(F)(F)F |
| InChI | InChI=1S/C10H20N4.C2HF3O/c1-7(2)12-10-8(3)13-14(6-5-11)9(10)4;3-2(4,5)1-6/h7,12H,5-6,11H2,1-4H3;1H |
| InChIKey | RURJIHRCAUWWEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|