About methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate
methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate (PubChem CID 160734201) has the molecular formula C18H19ClO6
and a molecular weight of 366.80 g/mol. Its IUPAC name is methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate.
Molecular Properties
| Compound Name | methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate |
| PubChem CID | 160734201 |
| Molecular Formula | C18H19ClO6 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(C)c1O.COC(=O)c1cccc(C)c1O |
| InChI | InChI=1S/C9H9ClO3.C9H10O3/c1-5-3-6(10)4-7(8(5)11)9(12)13-2;1-6-4-3-5-7(8(6)10)9(11)12-2/h3-4,11H,1-2H3;3-5,10H,1-2H3 |
| InChIKey | RUSSBFGFDJYPSY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate?
The IUPAC name of methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate (CID 160734201) is methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate.
What is the SMILES notation for methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate?
The canonical SMILES for methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate is COC(=O)c1cc(Cl)cc(C)c1O.COC(=O)c1cccc(C)c1O.
What is the InChIKey of methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate?
The InChIKey is RUSSBFGFDJYPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO3.C9H10O3/c1-5-3-6(10)4-7(8(5)11)9(12)13-2;1-6-4-3-5-7(8(6)10)9(11)12-2/h3-4,11H,1-2H3;3-5,10H,1-2H3.
What are the key properties of methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate?
methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate has a molecular weight of 366.80 g/mol, XLogP of 3.63, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-2-hydroxy-3-methylbenzoate;methyl 2-hydroxy-3-methylbenzoate is sourced from PubChem (CID 160734201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).