C15H21N7O8 — CID 160736234
N-(2-hydroxy-2-methylpropyl)-N,1-dimethyl-4-nitropyrazole-3-carboxamide;1-methyl-4-nitropyrazole-3-carboxylic acid (PubChem CID 160736234) has the molecular formula C15H21N7O8 and a molecular weight of 427.37 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-N,1-dimethyl-4-nitropyrazole-3-carboxamide;1-methyl-4-nitropyrazole-3-carboxylic acid.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-N,1-dimethyl-4-nitropyrazole-3-carboxamide;1-methyl-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 160736234 |
| Molecular Formula | C15H21N7O8 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-N,1-dimethyl-4-nitropyrazole-3-carboxamide;1-methyl-4-nitropyrazole-3-carboxylic acid |
| SMILES | CN(CC(C)(C)O)C(=O)c1nn(C)cc1[N+](=O)[O-].Cn1cc([N+](=O)[O-])c(C(=O)O)n1 |
| InChI | InChI=1S/C10H16N4O4.C5H5N3O4/c1-10(2,16)6-12(3)9(15)8-7(14(17)18)5-13(4)11-8;1-7-2-3(8(11)12)4(6-7)5(9)10/h5,16H,6H2,1-4H3;2H,1H3,(H,9,10) |
| InChIKey | RUZIFPIASFBOJZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 199.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|