About 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline
3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline (PubChem CID 160741942) has the molecular formula C26H21BrN2O
and a molecular weight of 457.37 g/mol. Its IUPAC name is 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline.
Molecular Properties
| Compound Name | 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline |
| PubChem CID | 160741942 |
| Molecular Formula | C26H21BrN2O |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline |
| SMILES | Brc1cnc2ccccc2c1.COc1ccccc1Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H15NO.C9H6BrN/c1-19-17-9-5-3-7-15(17)11-13-10-14-6-2-4-8-16(14)18-12-13;10-8-5-7-3-1-2-4-9(7)11-6-8/h2-10,12H,11H2,1H3;1-6H |
| InChIKey | RVRVIXOSXWIZGE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline?
The IUPAC name of 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline (CID 160741942) is 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline.
What is the SMILES notation for 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline?
The canonical SMILES for 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline is Brc1cnc2ccccc2c1.COc1ccccc1Cc1cnc2ccccc2c1.
What is the InChIKey of 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline?
The InChIKey is RVRVIXOSXWIZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO.C9H6BrN/c1-19-17-9-5-3-7-15(17)11-13-10-14-6-2-4-8-16(14)18-12-13;10-8-5-7-3-1-2-4-9(7)11-6-8/h2-10,12H,11H2,1H3;1-6H.
What are the key properties of 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline?
3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline has a molecular weight of 457.37 g/mol, XLogP of 6.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoquinoline;3-[(2-methoxyphenyl)methyl]quinoline is sourced from PubChem (CID 160741942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).