C17H37NO3S — CID 160742768
2-methylpropane-1-sulfonic acid;2-prop-1-enyldecan-1-amine (PubChem CID 160742768) has the molecular formula C17H37NO3S and a molecular weight of 335.55 g/mol. Its IUPAC name is 2-methylpropane-1-sulfonic acid;2-prop-1-enyldecan-1-amine.
| Compound Name | 2-methylpropane-1-sulfonic acid;2-prop-1-enyldecan-1-amine |
|---|---|
| PubChem CID | 160742768 |
| Molecular Formula | C17H37NO3S |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 2-methylpropane-1-sulfonic acid;2-prop-1-enyldecan-1-amine |
| SMILES | CC(C)CS(=O)(=O)O.CC=CC(CN)CCCCCCCC |
| InChI | InChI=1S/C13H27N.C4H10O3S/c1-3-5-6-7-8-9-11-13(12-14)10-4-2;1-4(2)3-8(5,6)7/h4,10,13H,3,5-9,11-12,14H2,1-2H3;4H,3H2,1-2H3,(H,5,6,7) |
| InChIKey | RVULXKYEIQSBBL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|