C21H21F3N2O2 — CID 160743861
[4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol (PubChem CID 160743861) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 160743861 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol |
| SMILES | CCCc1cc(OCc2cc(F)c(F)cc2F)n(Cc2ccc(CO)cc2)n1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-2-3-17-9-21(28-13-16-8-19(23)20(24)10-18(16)22)26(25-17)11-14-4-6-15(12-27)7-5-14/h4-10,27H,2-3,11-13H2,1H3 |
| InChIKey | RVYAGKXVMSBTRG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|