About [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol
[4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol (PubChem CID 160743861) has the molecular formula C21H21F3N2O2
and a molecular weight of 390.41 g/mol. Its IUPAC name is [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol |
| PubChem CID | 160743861 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol |
| SMILES | CCCc1cc(OCc2cc(F)c(F)cc2F)n(Cc2ccc(CO)cc2)n1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-2-3-17-9-21(28-13-16-8-19(23)20(24)10-18(16)22)26(25-17)11-14-4-6-15(12-27)7-5-14/h4-10,27H,2-3,11-13H2,1H3 |
| InChIKey | RVYAGKXVMSBTRG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol?
The IUPAC name of [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol (CID 160743861) is [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol?
The canonical SMILES for [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol is CCCc1cc(OCc2cc(F)c(F)cc2F)n(Cc2ccc(CO)cc2)n1.
What is the InChIKey of [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol?
The InChIKey is RVYAGKXVMSBTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3N2O2/c1-2-3-17-9-21(28-13-16-8-19(23)20(24)10-18(16)22)26(25-17)11-14-4-6-15(12-27)7-5-14/h4-10,27H,2-3,11-13H2,1H3.
What are the key properties of [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol?
[4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol has a molecular weight of 390.41 g/mol, XLogP of 4.37, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[3-propyl-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-1-yl]methyl]phenyl]methanol is sourced from PubChem (CID 160743861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).