C29H34N2OS3 — CID 160746034
1-(1-benzothiophen-3-yl)-3-[(1S,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propan-1-ol;sulfane (PubChem CID 160746034) has the molecular formula C29H34N2OS3 and a molecular weight of 522.81 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-[(1S,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propan-1-ol;sulfane.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-[(1S,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propan-1-ol;sulfane |
|---|---|
| PubChem CID | 160746034 |
| Molecular Formula | C29H34N2OS3 |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-[(1S,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propan-1-ol;sulfane |
| SMILES | OC(CCN1C[C@@H]2C/C=C\C[C@H]1CN2c1ccc2ccccc2c1)c1csc2ccccc12.S.S |
| InChI | InChI=1S/C29H30N2OS.2H2S/c32-28(27-20-33-29-12-6-5-11-26(27)29)15-16-30-18-25-10-4-3-9-24(30)19-31(25)23-14-13-21-7-1-2-8-22(21)17-23;;/h1-8,11-14,17,20,24-25,28,32H,9-10,15-16,18-19H2;2*1H2/b4-3-;;/t24-,25-,28?;;/m0../s1 |
| InChIKey | RWEWKVFFKKTRQY-WXRCCQIYSA-N |
| XLogP | 6.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|