C21H20F2N4O3 — CID 160749062
1-[2-[4-(difluoromethoxy)phenyl]triazol-4-yl]-2-[4-[(2S)-morpholin-2-yl]phenyl]ethanone (PubChem CID 160749062) has the molecular formula C21H20F2N4O3 and a molecular weight of 414.41 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]triazol-4-yl]-2-[4-[(2S)-morpholin-2-yl]phenyl]ethanone.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]triazol-4-yl]-2-[4-[(2S)-morpholin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 160749062 |
| Molecular Formula | C21H20F2N4O3 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]triazol-4-yl]-2-[4-[(2S)-morpholin-2-yl]phenyl]ethanone |
| SMILES | O=C(Cc1ccc([C@H]2CNCCO2)cc1)c1cnn(-c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C21H20F2N4O3/c22-21(23)30-17-7-5-16(6-8-17)27-25-12-18(26-27)19(28)11-14-1-3-15(4-2-14)20-13-24-9-10-29-20/h1-8,12,20-21,24H,9-11,13H2/t20-/m1/s1 |
| InChIKey | RWOOLIITHRMMBL-HXUWFJFHSA-N |
| XLogP | 2.95 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |