C21H24ClN5O3 — CID 90047249
2-(4-ethoxyphenyl)-N-(4-morpholin-2-ylphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 90047249) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(4-morpholin-2-ylphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(4-ethoxyphenyl)-N-(4-morpholin-2-ylphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 90047249 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(4-morpholin-2-ylphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(-n2ncc(C(=O)Nc3ccc(C4CNCCO4)cc3)n2)cc1.Cl |
| InChI | InChI=1S/C21H23N5O3.ClH/c1-2-28-18-9-7-17(8-10-18)26-23-13-19(25-26)21(27)24-16-5-3-15(4-6-16)20-14-22-11-12-29-20;/h3-10,13,20,22H,2,11-12,14H2,1H3,(H,24,27);1H |
| InChIKey | NFZXEARLNOGVFQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |