C17H31AlO4 — CID 160754706
alumane;1-[(3R)-2-oxooxolan-3-yl]tridecane-2,4-dione (PubChem CID 160754706) has the molecular formula C17H31AlO4 and a molecular weight of 326.41 g/mol. Its IUPAC name is alumane;1-[(3R)-2-oxooxolan-3-yl]tridecane-2,4-dione.
| Compound Name | alumane;1-[(3R)-2-oxooxolan-3-yl]tridecane-2,4-dione |
|---|---|
| PubChem CID | 160754706 |
| Molecular Formula | C17H31AlO4 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | alumane;1-[(3R)-2-oxooxolan-3-yl]tridecane-2,4-dione |
| SMILES | CCCCCCCCCC(=O)CC(=O)C[C@H]1CCOC1=O.[AlH3] |
| InChI | InChI=1S/C17H28O4.Al.3H/c1-2-3-4-5-6-7-8-9-15(18)13-16(19)12-14-10-11-21-17(14)20;;;;/h14H,2-13H2,1H3;;;;/t14-;;;;/m1..../s1 |
| InChIKey | RXGWXZUCGADHJY-WGVOJFRMSA-N |
| XLogP | 2.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|