About bis(2-ethoxyethanolate);iron(2+)
bis(2-ethoxyethanolate);iron(2+) (PubChem CID 160755483) has the molecular formula C8H18FeO4
and a molecular weight of 234.07 g/mol. Its IUPAC name is bis(2-ethoxyethanolate);iron(2+).
Molecular Properties
| Compound Name | bis(2-ethoxyethanolate);iron(2+) |
| PubChem CID | 160755483 |
| Molecular Formula | C8H18FeO4 |
| Molecular Weight | 234.07 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | bis(2-ethoxyethanolate);iron(2+) |
| SMILES | CCOCC[O-].CCOCC[O-].[Fe+2] |
| InChI | InChI=1S/2C4H9O2.Fe/c2*1-2-6-4-3-5;/h2*2-4H2,1H3;/q2*-1;+2 |
| InChIKey | RXJHNZUXQYKBMH-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.07 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethoxyethanolate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethoxyethanolate);iron(2+)?
The IUPAC name of bis(2-ethoxyethanolate);iron(2+) (CID 160755483) is bis(2-ethoxyethanolate);iron(2+).
What is the SMILES notation for bis(2-ethoxyethanolate);iron(2+)?
The canonical SMILES for bis(2-ethoxyethanolate);iron(2+) is CCOCC[O-].CCOCC[O-].[Fe+2].
What is the InChIKey of bis(2-ethoxyethanolate);iron(2+)?
The InChIKey is RXJHNZUXQYKBMH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9O2.Fe/c2*1-2-6-4-3-5;/h2*2-4H2,1H3;/q2*-1;+2.
What are the key properties of bis(2-ethoxyethanolate);iron(2+)?
bis(2-ethoxyethanolate);iron(2+) has a molecular weight of 234.07 g/mol, XLogP of -1.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethoxyethanolate);iron(2+) is sourced from PubChem (CID 160755483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).