About dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate
dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate (PubChem CID 160756345) has the molecular formula C24H35K2NO5+2
and a molecular weight of 495.74 g/mol. Its IUPAC name is dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate.
Molecular Properties
| Compound Name | dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate |
| PubChem CID | 160756345 |
| Molecular Formula | C24H35K2NO5+2 |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate |
| SMILES | CCCCCCCCCC(C)C(=O)Nc1ccc(C=C(C(=O)OC)C(=O)OC)cc1.[K+].[K+] |
| InChI | InChI=1S/C24H35NO5.2K/c1-5-6-7-8-9-10-11-12-18(2)22(26)25-20-15-13-19(14-16-20)17-21(23(27)29-3)24(28)30-4;;/h13-18H,5-12H2,1-4H3,(H,25,26);;/q;2*+1 |
| InChIKey | OAGSKFIGWFAYJJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate?
The IUPAC name of dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate (CID 160756345) is dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate.
What is the SMILES notation for dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate?
The canonical SMILES for dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate is CCCCCCCCCC(C)C(=O)Nc1ccc(C=C(C(=O)OC)C(=O)OC)cc1.[K+].[K+].
What is the InChIKey of dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate?
The InChIKey is OAGSKFIGWFAYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO5.2K/c1-5-6-7-8-9-10-11-12-18(2)22(26)25-20-15-13-19(14-16-20)17-21(23(27)29-3)24(28)30-4;;/h13-18H,5-12H2,1-4H3,(H,25,26);;/q;2*+1.
What are the key properties of dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate?
dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate has a molecular weight of 495.74 g/mol, XLogP of -0.86, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;dimethyl 2-[[4-(2-methylundecanoylamino)phenyl]methylidene]propanedioate is sourced from PubChem (CID 160756345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).