C22H22Cl2F2N2O6 — CID 160759298
3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoic acid;ethyl 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoate (PubChem CID 160759298) has the molecular formula C22H22Cl2F2N2O6 and a molecular weight of 519.33 g/mol. Its IUPAC name is 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoic acid;ethyl 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoate.
| Compound Name | 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoic acid;ethyl 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 160759298 |
| Molecular Formula | C22H22Cl2F2N2O6 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoic acid;ethyl 3-(2-chloro-3-fluoroanilino)-2-methyl-3-oxopropanoate |
| SMILES | CC(C(=O)O)C(=O)Nc1cccc(F)c1Cl.CCOC(=O)C(C)C(=O)Nc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H13ClFNO3.C10H9ClFNO3/c1-3-18-12(17)7(2)11(16)15-9-6-4-5-8(14)10(9)13;1-5(10(15)16)9(14)13-7-4-2-3-6(12)8(7)11/h4-7H,3H2,1-2H3,(H,15,16);2-5H,1H3,(H,13,14)(H,15,16) |
| InChIKey | RXVPXJBVJZZJDD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|