C29H37NO8 — CID 160764109
1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methylpent-3-enyl)butanedioate (PubChem CID 160764109) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methylpent-3-enyl)butanedioate.
| Compound Name | 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methylpent-3-enyl)butanedioate |
|---|---|
| PubChem CID | 160764109 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methylpent-3-enyl)butanedioate |
| SMILES | COC(=O)C[C@](O)(CCC=C(C)C)C(=O)OC1C(OC)=C[C@@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C29H37NO8/c1-18(2)7-5-10-29(33,16-24(31)35-4)27(32)38-26-23(34-3)15-28-9-6-11-30(28)12-8-19-13-21-22(37-17-36-21)14-20(19)25(26)28/h7,13-15,25-26,33H,5-6,8-12,16-17H2,1-4H3/t25-,26?,28-,29-/m1/s1 |
| InChIKey | RYLNKISPLNGJNS-KLGNKOOKSA-N |
| XLogP | 3.39 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|