C30H41NO8 — CID 163103890
1-O-[(2S,3S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(5-methylhexyl)butanedioate (PubChem CID 163103890) has the molecular formula C30H41NO8 and a molecular weight of 543.66 g/mol. Its IUPAC name is 1-O-[(2S,3S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(5-methylhexyl)butanedioate.
| Compound Name | 1-O-[(2S,3S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(5-methylhexyl)butanedioate |
|---|---|
| PubChem CID | 163103890 |
| Molecular Formula | C30H41NO8 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 1-O-[(2S,3S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(5-methylhexyl)butanedioate |
| SMILES | COC(=O)C[C@](O)(CCCCC(C)C)C(=O)O[C@@H]1C(OC)=C[C@@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C30H41NO8/c1-19(2)8-5-6-11-30(34,17-25(32)36-4)28(33)39-27-24(35-3)16-29-10-7-12-31(29)13-9-20-14-22-23(38-18-37-22)15-21(20)26(27)29/h14-16,19,26-27,34H,5-13,17-18H2,1-4H3/t26-,27-,29-,30-/m1/s1 |
| InChIKey | DRSNAXRLOVPLKQ-XQQPTAJKSA-N |
| XLogP | 3.86 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|