C20H33NO6S — CID 160764694
(E)-3-(hydroxymethoxy)prop-2-enoic acid;methane;(3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine (PubChem CID 160764694) has the molecular formula C20H33NO6S and a molecular weight of 415.55 g/mol. Its IUPAC name is (E)-3-(hydroxymethoxy)prop-2-enoic acid;methane;(3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine.
| Compound Name | (E)-3-(hydroxymethoxy)prop-2-enoic acid;methane;(3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine |
|---|---|
| PubChem CID | 160764694 |
| Molecular Formula | C20H33NO6S |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (E)-3-(hydroxymethoxy)prop-2-enoic acid;methane;(3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine |
| SMILES | C.CCCN1CCC[C@@H](c2cccc(S(C)(=O)=O)c2)C1.O=C(O)/C=C/OCO |
| InChI | InChI=1S/C15H23NO2S.C4H6O4.CH4/c1-3-9-16-10-5-7-14(12-16)13-6-4-8-15(11-13)19(2,17)18;5-3-8-2-1-4(6)7;/h4,6,8,11,14H,3,5,7,9-10,12H2,1-2H3;1-2,5H,3H2,(H,6,7);1H4/b;2-1+;/t14-;;/m1../s1 |
| InChIKey | RYNIVLLUMONZBR-DYXZTDSXSA-N |
| XLogP | 2.87 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|