About CID 160765795
CID 160765795 (PubChem CID 160765795) has the molecular formula C20H37NNaOSn
and a molecular weight of 449.22 g/mol.
Molecular Properties
| Compound Name | CID 160765795 |
| PubChem CID | 160765795 |
| Molecular Formula | C20H37NNaOSn |
| Molecular Weight | 449.22 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(OC(C)C)n1.[Na] |
| InChI | InChI=1S/C8H10NO.3C4H9.Na.Sn/c1-7(2)10-8-5-3-4-6-9-8;3*1-3-4-2;;/h3-5,7H,1-2H3;3*1,3-4H2,2H3;; |
| InChIKey | RYQZPMRKHJMDFD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.22 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 160765795 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160765795?
The IUPAC name of CID 160765795 (CID 160765795) is not available.
What is the SMILES notation for CID 160765795?
The canonical SMILES for CID 160765795 is CCCC[Sn](CCCC)(CCCC)c1cccc(OC(C)C)n1.[Na].
What is the InChIKey of CID 160765795?
The InChIKey is RYQZPMRKHJMDFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO.3C4H9.Na.Sn/c1-7(2)10-8-5-3-4-6-9-8;3*1-3-4-2;;/h3-5,7H,1-2H3;3*1,3-4H2,2H3;;.
What are the key properties of CID 160765795?
CID 160765795 has a molecular weight of 449.22 g/mol, XLogP of 5.54, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160765795 is sourced from PubChem (CID 160765795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).