C20H13BrN4 — CID 160769700
4-(6-bromo-2-pyridinyl)-2,6-dipyridin-4-ylpyridine (PubChem CID 160769700) has the molecular formula C20H13BrN4 and a molecular weight of 389.26 g/mol. Its IUPAC name is 4-(6-bromo-2-pyridinyl)-2,6-dipyridin-4-ylpyridine.
| Compound Name | 4-(6-bromo-2-pyridinyl)-2,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 160769700 |
| Molecular Formula | C20H13BrN4 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-(6-bromo-2-pyridinyl)-2,6-dipyridin-4-ylpyridine |
| SMILES | Brc1cccc(-c2cc(-c3ccncc3)nc(-c3ccncc3)c2)n1 |
| InChI | InChI=1S/C20H13BrN4/c21-20-3-1-2-17(25-20)16-12-18(14-4-8-22-9-5-14)24-19(13-16)15-6-10-23-11-7-15/h1-13H |
| InChIKey | VJBZTHPHUKYUMY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|