C28H41ClN8 — CID 160770131
butane-1,4-diamine;4-chloro-6,7-dimethylquinazoline;N'-(6,7-dimethylquinazolin-4-yl)butane-1,4-diamine (PubChem CID 160770131) has the molecular formula C28H41ClN8 and a molecular weight of 525.15 g/mol. Its IUPAC name is butane-1,4-diamine;4-chloro-6,7-dimethylquinazoline;N'-(6,7-dimethylquinazolin-4-yl)butane-1,4-diamine.
| Compound Name | butane-1,4-diamine;4-chloro-6,7-dimethylquinazoline;N'-(6,7-dimethylquinazolin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 160770131 |
| Molecular Formula | C28H41ClN8 |
| Molecular Weight | 525.15 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | butane-1,4-diamine;4-chloro-6,7-dimethylquinazoline;N'-(6,7-dimethylquinazolin-4-yl)butane-1,4-diamine |
| SMILES | Cc1cc2ncnc(Cl)c2cc1C.Cc1cc2ncnc(NCCCCN)c2cc1C.NCCCCN |
| InChI | InChI=1S/C14H20N4.C10H9ClN2.C4H12N2/c1-10-7-12-13(8-11(10)2)17-9-18-14(12)16-6-4-3-5-15;1-6-3-8-9(4-7(6)2)12-5-13-10(8)11;5-3-1-2-4-6/h7-9H,3-6,15H2,1-2H3,(H,16,17,18);3-5H,1-2H3;1-6H2 |
| InChIKey | RZEYFKOJRZSUOV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|