C39H46ClF3N6 — CID 160771412
2-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-imidazole;2-[(2,6-diethylphenyl)methyl]-1H-imidazole;2-[(2,3,5,6-tetramethylphenyl)methyl]-1H-imidazole (PubChem CID 160771412) has the molecular formula C39H46ClF3N6 and a molecular weight of 691.29 g/mol. Its IUPAC name is 2-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-imidazole;2-[(2,6-diethylphenyl)methyl]-1H-imidazole;2-[(2,3,5,6-tetramethylphenyl)methyl]-1H-imidazole.
| Compound Name | 2-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-imidazole;2-[(2,6-diethylphenyl)methyl]-1H-imidazole;2-[(2,3,5,6-tetramethylphenyl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 160771412 |
| Molecular Formula | C39H46ClF3N6 |
| Molecular Weight | 691.29 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | 2-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-imidazole;2-[(2,6-diethylphenyl)methyl]-1H-imidazole;2-[(2,3,5,6-tetramethylphenyl)methyl]-1H-imidazole |
| SMILES | CCc1cccc(CC)c1Cc1ncc[nH]1.Cc1cc(C)c(C)c(Cc2ncc[nH]2)c1C.FC(F)(F)c1cccc(CC2=NCCN2)c1Cl |
| InChI | InChI=1S/2C14H18N2.C11H10ClF3N2/c1-9-7-10(2)12(4)13(11(9)3)8-14-15-5-6-16-14;1-3-11-6-5-7-12(4-2)13(11)10-14-15-8-9-16-14;12-10-7(6-9-16-4-5-17-9)2-1-3-8(10)11(13,14)15/h5-7H,8H2,1-4H3,(H,15,16);5-9H,3-4,10H2,1-2H3,(H,15,16);1-3H,4-6H2,(H,16,17) |
| InChIKey | RZJFCQYKPFCJKH-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.29 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |