C14H14FN5O4 — CID 160780813
methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]-3-fluoropyridine-2-carboxylate (PubChem CID 160780813) has the molecular formula C14H14FN5O4 and a molecular weight of 335.30 g/mol. Its IUPAC name is methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]-3-fluoropyridine-2-carboxylate.
| Compound Name | methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]-3-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 160780813 |
| Molecular Formula | C14H14FN5O4 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]-3-fluoropyridine-2-carboxylate |
| SMILES | [H]/N=C1\N=C(N)CC(O)=C1CC(=O)Nc1cnc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C14H14FN5O4/c1-24-14(23)12-8(15)2-6(5-18-12)19-11(22)3-7-9(21)4-10(16)20-13(7)17/h2,5,21H,3-4H2,1H3,(H,19,22)(H3,16,17,20) |
| InChIKey | GZAPNOVQNGAJBF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|