methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate

C9H9F3N2O2 — CID 66802732

IUPACmethyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(NCC(F)(F)F)cn1
InChIInChI=1S/C9H9F3N2O2/c1-16-8(15)7-3-2-6(4-13-7)14-5-9(10,11)12/h2-4,14H,5H2,1H3
InChIKeyDKRJPJXSKOPORN-UHFFFAOYSA-N
MW234.18 g/mol
LogP1.84
Rot. Bonds3

About methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate

methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate (PubChem CID 66802732) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate
PubChem CID66802732
Molecular FormulaC9H9F3N2O2
Molecular Weight234.18 g/mol
Exact Mass234.06
IUPAC Namemethyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(NCC(F)(F)F)cn1
InChIInChI=1S/C9H9F3N2O2/c1-16-8(15)7-3-2-6(4-13-7)14-5-9(10,11)12/h2-4,14H,5H2,1H3
InChIKeyDKRJPJXSKOPORN-UHFFFAOYSA-N
XLogP1.84
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.18
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate?
The IUPAC name of methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate (CID 66802732) is methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate is COC(=O)c1ccc(NCC(F)(F)F)cn1.
What is the InChIKey of methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate?
The InChIKey is DKRJPJXSKOPORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2O2/c1-16-8(15)7-3-2-6(4-13-7)14-5-9(10,11)12/h2-4,14H,5H2,1H3.
What are the key properties of methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate?
methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate has a molecular weight of 234.18 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,2,2-trifluoroethylamino)pyridine-2-carboxylate is sourced from PubChem (CID 66802732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).