methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate

C14H20N2O3 — CID 170275874

IUPACmethyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(NC(=O)C(C)CC(C)C)cn1
InChIInChI=1S/C14H20N2O3/c1-9(2)7-10(3)13(17)16-11-5-6-12(15-8-11)14(18)19-4/h5-6,8-10H,7H2,1-4H3,(H,16,17)
InChIKeyRJYBKKBSOJRBJH-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.49
Rot. Bonds5

About methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate

methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate (PubChem CID 170275874) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate
PubChem CID170275874
Molecular FormulaC14H20N2O3
Molecular Weight264.32 g/mol
Exact Mass264.15
IUPAC Namemethyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(NC(=O)C(C)CC(C)C)cn1
InChIInChI=1S/C14H20N2O3/c1-9(2)7-10(3)13(17)16-11-5-6-12(15-8-11)14(18)19-4/h5-6,8-10H,7H2,1-4H3,(H,16,17)
InChIKeyRJYBKKBSOJRBJH-UHFFFAOYSA-N
XLogP2.49
TPSA68.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate?
The IUPAC name of methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate (CID 170275874) is methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate is COC(=O)c1ccc(NC(=O)C(C)CC(C)C)cn1.
What is the InChIKey of methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate?
The InChIKey is RJYBKKBSOJRBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-9(2)7-10(3)13(17)16-11-5-6-12(15-8-11)14(18)19-4/h5-6,8-10H,7H2,1-4H3,(H,16,17).
What are the key properties of methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate?
methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate has a molecular weight of 264.32 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-dimethylpentanoylamino)pyridine-2-carboxylate is sourced from PubChem (CID 170275874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).