C13H19N2O6P — CID 169288588
[1-[(6-methoxycarbonyl-3-pyridinyl)amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid (PubChem CID 169288588) has the molecular formula C13H19N2O6P and a molecular weight of 330.28 g/mol. Its IUPAC name is [1-[(6-methoxycarbonyl-3-pyridinyl)amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [1-[(6-methoxycarbonyl-3-pyridinyl)amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 169288588 |
| Molecular Formula | C13H19N2O6P |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [1-[(6-methoxycarbonyl-3-pyridinyl)amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
| SMILES | COC(=O)c1ccc(NC(=O)C(CC(C)C)P(=O)(O)O)cn1 |
| InChI | InChI=1S/C13H19N2O6P/c1-8(2)6-11(22(18,19)20)12(16)15-9-4-5-10(14-7-9)13(17)21-3/h4-5,7-8,11H,6H2,1-3H3,(H,15,16)(H2,18,19,20) |
| InChIKey | VOLJCVXDDQFVSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|