C19H25ClN3O5P — CID 169288567
[1-[[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid (PubChem CID 169288567) has the molecular formula C19H25ClN3O5P and a molecular weight of 441.85 g/mol. Its IUPAC name is [1-[[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [1-[[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 169288567 |
| Molecular Formula | C19H25ClN3O5P |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [1-[[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
| SMILES | CC(C)CC(C(=O)Nc1cnc(-c2ccc(OC(C)C)c(Cl)c2)nc1)P(=O)(O)O |
| InChI | InChI=1S/C19H25ClN3O5P/c1-11(2)7-17(29(25,26)27)19(24)23-14-9-21-18(22-10-14)13-5-6-16(15(20)8-13)28-12(3)4/h5-6,8-12,17H,7H2,1-4H3,(H,23,24)(H2,25,26,27) |
| InChIKey | SKVSHCOCRGYQNH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|