C9H15NO — CID 160789382
1,2-diethyl-2H-pyridin-3-ol (PubChem CID 160789382) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1,2-diethyl-2H-pyridin-3-ol.
| Compound Name | 1,2-diethyl-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 160789382 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1,2-diethyl-2H-pyridin-3-ol |
| SMILES | CCC1C(O)=CC=CN1CC |
| InChI | InChI=1S/C9H15NO/c1-3-8-9(11)6-5-7-10(8)4-2/h5-8,11H,3-4H2,1-2H3 |
| InChIKey | SBQDWLQRYWCANV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |