C11H19NO — CID 142862938
6-(diethylamino)-3-methylcyclohexa-1,3-dien-1-ol (PubChem CID 142862938) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 6-(diethylamino)-3-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | 6-(diethylamino)-3-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142862938 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 6-(diethylamino)-3-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CCN(CC)C1CC=C(C)C=C1O |
| InChI | InChI=1S/C11H19NO/c1-4-12(5-2)10-7-6-9(3)8-11(10)13/h6,8,10,13H,4-5,7H2,1-3H3 |
| InChIKey | QHWNWNRWPAZNQU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |