About 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol
2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol (PubChem CID 176920906) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol.
Analyze 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol?
The IUPAC name of 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol (CID 176920906) is 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol.
What is the SMILES notation for 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol?
The canonical SMILES for 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol is CC(C)N1CC=C(O)CC1C.
What is the InChIKey of 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol?
The InChIKey is PDALZXTXXQOEER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-7(2)10-5-4-9(11)6-8(10)3/h4,7-8,11H,5-6H2,1-3H3.
What are the key properties of 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol?
2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol has a molecular weight of 155.24 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-4-ol is sourced from PubChem (CID 176920906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).