About N'-propanethioylpropanethiohydrazide;pyridine
N'-propanethioylpropanethiohydrazide;pyridine (PubChem CID 160799878) has the molecular formula C11H17N3S2
and a molecular weight of 255.41 g/mol. Its IUPAC name is N'-propanethioylpropanethiohydrazide;pyridine.
Molecular Properties
| Compound Name | N'-propanethioylpropanethiohydrazide;pyridine |
| PubChem CID | 160799878 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N'-propanethioylpropanethiohydrazide;pyridine |
| SMILES | CCC(=S)NNC(=S)CC.c1ccncc1 |
| InChI | InChI=1S/C6H12N2S2.C5H5N/c1-3-5(9)7-8-6(10)4-2;1-2-4-6-5-3-1/h3-4H2,1-2H3,(H,7,9)(H,8,10);1-5H |
| InChIKey | SCXXLDRIWMZZSI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N'-propanethioylpropanethiohydrazide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-propanethioylpropanethiohydrazide;pyridine?
The IUPAC name of N'-propanethioylpropanethiohydrazide;pyridine (CID 160799878) is N'-propanethioylpropanethiohydrazide;pyridine.
What is the SMILES notation for N'-propanethioylpropanethiohydrazide;pyridine?
The canonical SMILES for N'-propanethioylpropanethiohydrazide;pyridine is CCC(=S)NNC(=S)CC.c1ccncc1.
What is the InChIKey of N'-propanethioylpropanethiohydrazide;pyridine?
The InChIKey is SCXXLDRIWMZZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S2.C5H5N/c1-3-5(9)7-8-6(10)4-2;1-2-4-6-5-3-1/h3-4H2,1-2H3,(H,7,9)(H,8,10);1-5H.
What are the key properties of N'-propanethioylpropanethiohydrazide;pyridine?
N'-propanethioylpropanethiohydrazide;pyridine has a molecular weight of 255.41 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-propanethioylpropanethiohydrazide;pyridine is sourced from PubChem (CID 160799878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).