C4H14Br2N2 — CID 160800492
2-azaniumylethyl(ethyl)azanium dibromide (PubChem CID 160800492) has the molecular formula C4H14Br2N2 and a molecular weight of 249.98 g/mol. Its IUPAC name is 2-azaniumylethyl(ethyl)azanium dibromide.
| Compound Name | 2-azaniumylethyl(ethyl)azanium dibromide |
|---|---|
| PubChem CID | 160800492 |
| Molecular Formula | C4H14Br2N2 |
| Molecular Weight | 249.98 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 2-azaniumylethyl(ethyl)azanium dibromide |
| SMILES | CC[NH2+]CC[NH3+].[Br-].[Br-] |
| InChI | InChI=1S/C4H12N2.2BrH/c1-2-6-4-3-5;;/h6H,2-5H2,1H3;2*1H |
| InChIKey | GOCBSOGGTAJPER-UHFFFAOYSA-N |
| XLogP | -8.18 |
| TPSA | 44.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.98 |
| LogP ≤ 5 | -8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|