About 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate)
2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) (PubChem CID 139145505) has the molecular formula C14H30N4O8
and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate).
Molecular Properties
| Compound Name | 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) |
| PubChem CID | 139145505 |
| Molecular Formula | C14H30N4O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) |
| SMILES | O=C([O-])CCC(=O)[O-].O=C([O-])CCC(=O)[O-].[NH3+]CC[NH2+]CC[NH2+]CC[NH3+] |
| InChI | InChI=1S/C6H18N4.2C4H6O4/c7-1-3-9-5-6-10-4-2-8;2*5-3(6)1-2-4(7)8/h9-10H,1-8H2;2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | SCVIYTAVKJBBEL-UHFFFAOYSA-N |
| XLogP | -10.87 |
| TPSA | 249.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | -10.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate)?
The IUPAC name of 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) (CID 139145505) is 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate).
What is the SMILES notation for 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate)?
The canonical SMILES for 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) is O=C([O-])CCC(=O)[O-].O=C([O-])CCC(=O)[O-].[NH3+]CC[NH2+]CC[NH2+]CC[NH3+].
What is the InChIKey of 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate)?
The InChIKey is SCVIYTAVKJBBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.2C4H6O4/c7-1-3-9-5-6-10-4-2-8;2*5-3(6)1-2-4(7)8/h9-10H,1-8H2;2*1-2H2,(H,5,6)(H,7,8).
What are the key properties of 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate)?
2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) has a molecular weight of 382.41 g/mol, XLogP of -10.87, 13 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethyl-[2-(2-azaniumylethylazaniumyl)ethyl]azanium;bis(butanedioate) is sourced from PubChem (CID 139145505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).