About bis(bis(2-hydroxyethyl)azanium);butanedioate
bis(bis(2-hydroxyethyl)azanium);butanedioate (PubChem CID 87299345) has the molecular formula C12H28N2O8
and a molecular weight of 328.36 g/mol. Its IUPAC name is bis(bis(2-hydroxyethyl)azanium);butanedioate.
Molecular Properties
| Compound Name | bis(bis(2-hydroxyethyl)azanium);butanedioate |
| PubChem CID | 87299345 |
| Molecular Formula | C12H28N2O8 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | bis(bis(2-hydroxyethyl)azanium);butanedioate |
| SMILES | O=C([O-])CCC(=O)[O-].OCC[NH2+]CCO.OCC[NH2+]CCO |
| InChI | InChI=1S/2C4H11NO2.C4H6O4/c2*6-3-1-5-2-4-7;5-3(6)1-2-4(7)8/h2*5-7H,1-4H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | ACSMYWVXUDYOKS-UHFFFAOYSA-N |
| XLogP | -7.66 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | -7.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(2-hydroxyethyl)azanium);butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(2-hydroxyethyl)azanium);butanedioate?
The IUPAC name of bis(bis(2-hydroxyethyl)azanium);butanedioate (CID 87299345) is bis(bis(2-hydroxyethyl)azanium);butanedioate.
What is the SMILES notation for bis(bis(2-hydroxyethyl)azanium);butanedioate?
The canonical SMILES for bis(bis(2-hydroxyethyl)azanium);butanedioate is O=C([O-])CCC(=O)[O-].OCC[NH2+]CCO.OCC[NH2+]CCO.
What is the InChIKey of bis(bis(2-hydroxyethyl)azanium);butanedioate?
The InChIKey is ACSMYWVXUDYOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11NO2.C4H6O4/c2*6-3-1-5-2-4-7;5-3(6)1-2-4(7)8/h2*5-7H,1-4H2;1-2H2,(H,5,6)(H,7,8).
What are the key properties of bis(bis(2-hydroxyethyl)azanium);butanedioate?
bis(bis(2-hydroxyethyl)azanium);butanedioate has a molecular weight of 328.36 g/mol, XLogP of -7.66, 11 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(2-hydroxyethyl)azanium);butanedioate is sourced from PubChem (CID 87299345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).