About cesium 3-hydroxypropanoate
cesium 3-hydroxypropanoate (PubChem CID 20822790) has the molecular formula C3H5CsO3
and a molecular weight of 221.97 g/mol. Its IUPAC name is cesium 3-hydroxypropanoate.
Molecular Properties
| Compound Name | cesium 3-hydroxypropanoate |
| PubChem CID | 20822790 |
| Molecular Formula | C3H5CsO3 |
| Molecular Weight | 221.97 g/mol |
| Exact Mass | 221.93 |
| IUPAC Name | cesium 3-hydroxypropanoate |
| SMILES | O=C([O-])CCO.[Cs+] |
| InChI | InChI=1S/C3H6O3.Cs/c4-2-1-3(5)6;/h4H,1-2H2,(H,5,6);/q;+1/p-1 |
| InChIKey | KJUNNLOHFQOKDM-UHFFFAOYSA-M |
| XLogP | -4.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.97 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cesium 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 3-hydroxypropanoate?
The IUPAC name of cesium 3-hydroxypropanoate (CID 20822790) is cesium 3-hydroxypropanoate.
What is the SMILES notation for cesium 3-hydroxypropanoate?
The canonical SMILES for cesium 3-hydroxypropanoate is O=C([O-])CCO.[Cs+].
What is the InChIKey of cesium 3-hydroxypropanoate?
The InChIKey is KJUNNLOHFQOKDM-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.Cs/c4-2-1-3(5)6;/h4H,1-2H2,(H,5,6);/q;+1/p-1.
What are the key properties of cesium 3-hydroxypropanoate?
cesium 3-hydroxypropanoate has a molecular weight of 221.97 g/mol, XLogP of -4.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 3-hydroxypropanoate is sourced from PubChem (CID 20822790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).