About bis(2-hydroxyethyl)azanium;decanoate
bis(2-hydroxyethyl)azanium;decanoate (PubChem CID 87299732) has the molecular formula C14H31NO4
and a molecular weight of 277.40 g/mol. Its IUPAC name is bis(2-hydroxyethyl)azanium;decanoate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl)azanium;decanoate |
| PubChem CID | 87299732 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | bis(2-hydroxyethyl)azanium;decanoate |
| SMILES | CCCCCCCCCC(=O)[O-].OCC[NH2+]CCO |
| InChI | InChI=1S/C10H20O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-10(11)12;6-3-1-5-2-4-7/h2-9H2,1H3,(H,11,12);5-7H,1-4H2 |
| InChIKey | ZCNCBFKBQRZZFC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl)azanium;decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl)azanium;decanoate?
The IUPAC name of bis(2-hydroxyethyl)azanium;decanoate (CID 87299732) is bis(2-hydroxyethyl)azanium;decanoate.
What is the SMILES notation for bis(2-hydroxyethyl)azanium;decanoate?
The canonical SMILES for bis(2-hydroxyethyl)azanium;decanoate is CCCCCCCCCC(=O)[O-].OCC[NH2+]CCO.
What is the InChIKey of bis(2-hydroxyethyl)azanium;decanoate?
The InChIKey is ZCNCBFKBQRZZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-10(11)12;6-3-1-5-2-4-7/h2-9H2,1H3,(H,11,12);5-7H,1-4H2.
What are the key properties of bis(2-hydroxyethyl)azanium;decanoate?
bis(2-hydroxyethyl)azanium;decanoate has a molecular weight of 277.40 g/mol, XLogP of -0.59, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)azanium;decanoate is sourced from PubChem (CID 87299732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).