C19H25BClF3N2O4 — CID 160802670
[1-[[4-[(2S)-1-[4-chloro-2-(trifluoromethyl)phenyl]azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 160802670) has the molecular formula C19H25BClF3N2O4 and a molecular weight of 448.68 g/mol. Its IUPAC name is [1-[[4-[(2S)-1-[4-chloro-2-(trifluoromethyl)phenyl]azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[4-[(2S)-1-[4-chloro-2-(trifluoromethyl)phenyl]azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 160802670 |
| Molecular Formula | C19H25BClF3N2O4 |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [1-[[4-[(2S)-1-[4-chloro-2-(trifluoromethyl)phenyl]azetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)CCC(=O)[C@@H]1CCN1c1ccc(Cl)cc1C(F)(F)F)B(O)O |
| InChI | InChI=1S/C19H25BClF3N2O4/c1-11(2)9-17(20(29)30)25-18(28)6-5-16(27)15-7-8-26(15)14-4-3-12(21)10-13(14)19(22,23)24/h3-4,10-11,15,17,29-30H,5-9H2,1-2H3,(H,25,28)/t15-,17?/m0/s1 |
| InChIKey | SDHCSIXGWKKIJN-MYJWUSKBSA-N |
| XLogP | 2.83 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|