C27H37NO4 — CID 160806894
1-[4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butoxy]-2,5-dimethylphenyl]-N-methoxyethanimine (PubChem CID 160806894) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-[4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butoxy]-2,5-dimethylphenyl]-N-methoxyethanimine.
| Compound Name | 1-[4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butoxy]-2,5-dimethylphenyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 160806894 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 1-[4-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butoxy]-2,5-dimethylphenyl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCCCOc2cc(C)c(C(C)=NOC)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H37NO4/c1-8-9-12-30-24-15-21(4)27(22(5)16-24)32-14-11-10-13-31-26-18-19(2)25(17-20(26)3)23(6)28-29-7/h8-9,15-18H,10-14H2,1-7H3/b9-8+,28-23? |
| InChIKey | OTQKTSJCKVDEPK-KODFCKOTSA-N |
| XLogP | 6.48 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|